Reaction Kinetics and Catalysis Letters, Vol.92, No.1, 27-31, 2007
Kinetics and mechanisms of homogeneous catalytic reactions. Part 8. Regioselective reduction of benzo[b]thiophene catalyzed by OsH(CO)(kappa(3)-OCOCH3)(PPh3)(2)
The complex OsH(CO)(kappa(3)-OCOCH3)(PPh3)(2) (1) catalyzes the reduction of benzo[b]thiophene (BT) to 2,3-dihydrobenzo[b]thiophene (DHBT), under mild reaction conditions. A kinetic study lead to the rate law: r = K(1)K(2)k(3)/{1+K-1(1+K-2)[BT]}[Os][BT][H-2]. A catalytic cycle was proposed, which involves the oxidative addition of hydrogen as rate-determining step.