Molecular Crystals and Liquid Crystals, Vol.623, No.1, 343-350, 2015
Synthesis and Crystal Structure of 4-(3,4,5-Trimethoxyphenyl)-N3,N5-BIS(3-Chloro-4-Fluoro-Phenyl)-2,6-Dimet hyl-Pyridine
The title compound, C30H29Cl2F2N3O7, crystallizes in the triclinic crystal system and space group P-1 with cell parameters a = 7.0250(18) angstrom, b = 14.311(5) angstrom, c = 15.841(6) angstrom, alpha = 107.437(7)degrees, beta = 91.69(2)degrees, gamma = 100.36(2)degrees, V = 1488.7(9) angstrom(3) for Z = 2. The structure exhibits inter-molecular hydrogen bonds of the type N-H center dot center dot center dot O.