검색결과 : 5건
| No. | Article |
|---|---|
| 1 |
Crown and Bowl-Shaped Clusters of Uranyl Polyhedra Sigmon GE, Weaver B, Kubatko KA, Burns PC Inorganic Chemistry, 48(23), 10907, 2009 |
| 2 |
Expanding the crystal chemistry of uranyl peroxides: Synthesis and structures of Di- and triperoxodioxouranium(VI) complexes Kubatko KA, Forbes TZ, Klingensmith AL, Burns PC Inorganic Chemistry, 46(9), 3657, 2007 |
| 3 |
Tetraalkylphosphonium polyoxometalate ionic liquids: Novel, organic-inorganic hybrid materials Rickert PG, Antonio MR, Firestone MA, Kubatko KA, Szreder T, Wishart JF, Dietz ML Journal of Physical Chemistry B, 111(18), 4685, 2007 |
| 4 |
Expanding the crystal chemistry of actinyl peroxides: Open sheets of uranyl polyhedra in Na-5[(UO2)(3)(O-2)(4)(OH)(3)](H2O)(13) Kubatko KA, Burns PC Inorganic Chemistry, 45(16), 6096, 2006 |
| 5 |
Cation-cation interactions in Sr-5(UO2)(20)(UO6)(2)O-16(OH)(6)(H2O)(6) and Cs(UO2)(9)U3O16(OH)(5) Kubatko KA, Burns PC Inorganic Chemistry, 45(25), 10277, 2006 |